About 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid
2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid (PubChem CID 115127969) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid.
Analyze 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid?
The IUPAC name of 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid (CID 115127969) is 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid.
What is the SMILES notation for 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid?
The canonical SMILES for 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid is Cc1cc(C)c(CNC(C)(C)C(=O)O)cc1C.
What is the InChIKey of 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid?
The InChIKey is LACKAVITFJDNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-9-6-11(3)12(7-10(9)2)8-15-14(4,5)13(16)17/h6-7,15H,8H2,1-5H3,(H,16,17).
What are the key properties of 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid?
2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid has a molecular weight of 235.33 g/mol, XLogP of 2.56, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2,4,5-trimethylphenyl)methylamino]propanoic acid is sourced from PubChem (CID 115127969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).