About 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine
9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine (PubChem CID 11512802) has the molecular formula C19H25IN6OS
and a molecular weight of 512.42 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine.
Molecular Properties
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine |
| PubChem CID | 11512802 |
| Molecular Formula | C19H25IN6OS |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine |
| SMILES | COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCNCC(C)(C)C)c1 |
| InChI | InChI=1S/C19H25IN6OS/c1-19(2,3)10-22-7-8-26-17-15(16(21)23-11-24-17)25-18(26)28-14-9-12(27-4)5-6-13(14)20/h5-6,9,11,22H,7-8,10H2,1-4H3,(H2,21,23,24) |
| InChIKey | FGUVIEZMWVLUBS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine?
The IUPAC name of 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine (CID 11512802) is 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine.
What is the SMILES notation for 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine?
The canonical SMILES for 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine is COc1ccc(I)c(Sc2nc3c(N)ncnc3n2CCNCC(C)(C)C)c1.
What is the InChIKey of 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine?
The InChIKey is FGUVIEZMWVLUBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25IN6OS/c1-19(2,3)10-22-7-8-26-17-15(16(21)23-11-24-17)25-18(26)28-14-9-12(27-4)5-6-13(14)20/h5-6,9,11,22H,7-8,10H2,1-4H3,(H2,21,23,24).
What are the key properties of 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine?
9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine has a molecular weight of 512.42 g/mol, XLogP of 3.81, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-(2,2-dimethylpropylamino)ethyl]-8-(2-iodo-5-methoxyphenyl)sulfanylpurin-6-amine is sourced from PubChem (CID 11512802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).