C34H40N6O5 — CID 11512816
3-N-cyano-1-[2-oxo-2-[[(1S,2S)-2-phenylmethoxycyclohexyl]amino]ethyl]-5-N-[(1S,2S)-2-phenylmethoxycyclohexyl]pyrazole-3,5-dicarboxamide (PubChem CID 11512816) has the molecular formula C34H40N6O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is 3-N-cyano-1-[2-oxo-2-[[(1S,2S)-2-phenylmethoxycyclohexyl]amino]ethyl]-5-N-[(1S,2S)-2-phenylmethoxycyclohexyl]pyrazole-3,5-dicarboxamide.
| Compound Name | 3-N-cyano-1-[2-oxo-2-[[(1S,2S)-2-phenylmethoxycyclohexyl]amino]ethyl]-5-N-[(1S,2S)-2-phenylmethoxycyclohexyl]pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 11512816 |
| Molecular Formula | C34H40N6O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.31 |
| IUPAC Name | 3-N-cyano-1-[2-oxo-2-[[(1S,2S)-2-phenylmethoxycyclohexyl]amino]ethyl]-5-N-[(1S,2S)-2-phenylmethoxycyclohexyl]pyrazole-3,5-dicarboxamide |
| SMILES | N#CNC(=O)c1cc(C(=O)N[C@H]2CCCC[C@@H]2OCc2ccccc2)n(CC(=O)N[C@H]2CCCC[C@@H]2OCc2ccccc2)n1 |
| InChI | InChI=1S/C34H40N6O5/c35-23-36-33(42)28-19-29(34(43)38-27-16-8-10-18-31(27)45-22-25-13-5-2-6-14-25)40(39-28)20-32(41)37-26-15-7-9-17-30(26)44-21-24-11-3-1-4-12-24/h1-6,11-14,19,26-27,30-31H,7-10,15-18,20-22H2,(H,36,42)(H,37,41)(H,38,43)/t26-,27-,30-,31-/m0/s1 |
| InChIKey | BZJWZTJZJJEVDD-FXZOGHEHSA-N |
| XLogP | 4.00 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|