C32H44N4O9 — CID 11512904
2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid (PubChem CID 11512904) has the molecular formula C32H44N4O9 and a molecular weight of 628.72 g/mol. Its IUPAC name is 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid.
| Compound Name | 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11512904 |
| Molecular Formula | C32H44N4O9 |
| Molecular Weight | 628.72 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 2-[[3-[[(7R,9S,12S)-12-cyclohexyl-11,14-dioxo-2,6-dioxa-10,13-diazatricyclo[14.3.1.17,10]henicosa-1(19),16(20),17-triene-9-carbonyl]amino]-2-oxohexanoyl]amino]acetic acid |
| SMILES | CCCC(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C1CCCCC1)NC(=O)Cc1cccc(c1)OCCCO2)C(=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C32H44N4O9/c1-2-8-24(29(40)31(42)33-18-27(38)39)34-30(41)25-17-23-19-36(25)32(43)28(21-10-4-3-5-11-21)35-26(37)16-20-9-6-12-22(15-20)44-13-7-14-45-23/h6,9,12,15,21,23-25,28H,2-5,7-8,10-11,13-14,16-19H2,1H3,(H,33,42)(H,34,41)(H,35,37)(H,38,39)/t23-,24?,25+,28+/m1/s1 |
| InChIKey | RNFQOFNPWITQST-UGUJXKDMSA-N |
| XLogP | 1.12 |
| TPSA | 180.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.72 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|