C15H19N3 — CID 115130659
2-[[2-(1H-indol-3-yl)-2-methylpropyl]amino]propanenitrile (PubChem CID 115130659) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-[[2-(1H-indol-3-yl)-2-methylpropyl]amino]propanenitrile.
| Compound Name | 2-[[2-(1H-indol-3-yl)-2-methylpropyl]amino]propanenitrile |
|---|---|
| PubChem CID | 115130659 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 2-[[2-(1H-indol-3-yl)-2-methylpropyl]amino]propanenitrile |
| SMILES | CC(C#N)NCC(C)(C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H19N3/c1-11(8-16)18-10-15(2,3)13-9-17-14-7-5-4-6-12(13)14/h4-7,9,11,17-18H,10H2,1-3H3 |
| InChIKey | KKVMEPKVSMTGKN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |