C38H78O4Si3 — CID 11513139
tert-butyl-dimethyl-[(2R)-2-[(2S,3R)-3-[(1S,2E,6E)-7-methyl-1,8-bis[tri(propan-2-yl)silyloxy]octa-2,6-dienyl]oxiran-2-yl]propoxy]silane (PubChem CID 11513139) has the molecular formula C38H78O4Si3 and a molecular weight of 683.30 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-2-[(2S,3R)-3-[(1S,2E,6E)-7-methyl-1,8-bis[tri(propan-2-yl)silyloxy]octa-2,6-dienyl]oxiran-2-yl]propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R)-2-[(2S,3R)-3-[(1S,2E,6E)-7-methyl-1,8-bis[tri(propan-2-yl)silyloxy]octa-2,6-dienyl]oxiran-2-yl]propoxy]silane |
|---|---|
| PubChem CID | 11513139 |
| Molecular Formula | C38H78O4Si3 |
| Molecular Weight | 683.30 g/mol |
| Exact Mass | 682.52 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-2-[(2S,3R)-3-[(1S,2E,6E)-7-methyl-1,8-bis[tri(propan-2-yl)silyloxy]octa-2,6-dienyl]oxiran-2-yl]propoxy]silane |
| SMILES | C/C(=C\CC/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[C@H]1[C@H](C)CO[Si](C)(C)C(C)(C)C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H78O4Si3/c1-27(2)44(28(3)4,29(5)6)40-25-33(13)23-21-20-22-24-35(42-45(30(7)8,31(9)10)32(11)12)37-36(41-37)34(14)26-39-43(18,19)38(15,16)17/h22-24,27-32,34-37H,20-21,25-26H2,1-19H3/b24-22+,33-23+/t34-,35+,36+,37+/m1/s1 |
| InChIKey | ZOVCRCIAXGFTST-XQNFJRLLSA-N |
| XLogP | 12.45 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.30 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|