C68H84N2S6 — CID 11513642
2,9-bis[3,4-dibutyl-5-[5-(3,4-dibutylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1,10-phenanthroline (PubChem CID 11513642) has the molecular formula C68H84N2S6 and a molecular weight of 1121.84 g/mol. Its IUPAC name is 2,9-bis[3,4-dibutyl-5-[5-(3,4-dibutylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[3,4-dibutyl-5-[5-(3,4-dibutylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 11513642 |
| Molecular Formula | C68H84N2S6 |
| Molecular Weight | 1121.84 g/mol |
| Exact Mass | 1120.50 |
| IUPAC Name | 2,9-bis[3,4-dibutyl-5-[5-(3,4-dibutylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-1,10-phenanthroline |
| SMILES | CCCCc1csc(-c2ccc(-c3sc(-c4ccc5ccc6ccc(-c7sc(-c8ccc(-c9scc(CCCC)c9CCCC)s8)c(CCCC)c7CCCC)nc6c5n4)c(CCCC)c3CCCC)s2)c1CCCC |
| InChI | InChI=1S/C68H84N2S6/c1-9-17-25-47-43-71-65(49(47)27-19-11-3)57-39-41-59(73-57)67-53(31-23-15-7)51(29-21-13-5)63(75-67)55-37-35-45-33-34-46-36-38-56(70-62(46)61(45)69-55)64-52(30-22-14-6)54(32-24-16-8)68(76-64)60-42-40-58(74-60)66-50(28-20-12-4)48(44-72-66)26-18-10-2/h33-44H,9-32H2,1-8H3 |
| InChIKey | HVXIPSRIYOYEDJ-UHFFFAOYSA-N |
| XLogP | 23.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.84 |
| LogP ≤ 5 | 23.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|