About 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one
1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one (PubChem CID 11513779) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one.
Molecular Properties
| Compound Name | 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one |
| PubChem CID | 11513779 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one |
| SMILES | C/C=C/C=C/COCC(C)=O |
| InChI | InChI=1S/C9H14O2/c1-3-4-5-6-7-11-8-9(2)10/h3-6H,7-8H2,1-2H3/b4-3+,6-5+ |
| InChIKey | ALMMXEIKAHPDFX-VNKDHWASSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one?
The IUPAC name of 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one (CID 11513779) is 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one.
What is the SMILES notation for 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one?
The canonical SMILES for 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one is C/C=C/C=C/COCC(C)=O.
What is the InChIKey of 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one?
The InChIKey is ALMMXEIKAHPDFX-VNKDHWASSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-4-5-6-7-11-8-9(2)10/h3-6H,7-8H2,1-2H3/b4-3+,6-5+.
What are the key properties of 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one?
1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one has a molecular weight of 154.21 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4E)-hexa-2,4-dienoxy]propan-2-one is sourced from PubChem (CID 11513779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).