C15H21NO3 — CID 115138677
ethyl 3-[(2-methyl-2-phenylpropyl)amino]-3-oxopropanoate (PubChem CID 115138677) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is ethyl 3-[(2-methyl-2-phenylpropyl)amino]-3-oxopropanoate.
| Compound Name | ethyl 3-[(2-methyl-2-phenylpropyl)amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 115138677 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethyl 3-[(2-methyl-2-phenylpropyl)amino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)NCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-4-19-14(18)10-13(17)16-11-15(2,3)12-8-6-5-7-9-12/h5-9H,4,10-11H2,1-3H3,(H,16,17) |
| InChIKey | JOPSVPXXRNCPSQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|