C11H20O2 — CID 11513879
(E,5S,6S)-6-hydroxy-5,7,7-trimethyloct-2-en-4-one (PubChem CID 11513879) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (E,5S,6S)-6-hydroxy-5,7,7-trimethyloct-2-en-4-one.
| Compound Name | (E,5S,6S)-6-hydroxy-5,7,7-trimethyloct-2-en-4-one |
|---|---|
| PubChem CID | 11513879 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (E,5S,6S)-6-hydroxy-5,7,7-trimethyloct-2-en-4-one |
| SMILES | C/C=C/C(=O)[C@@H](C)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-6-7-9(12)8(2)10(13)11(3,4)5/h6-8,10,13H,1-5H3/b7-6+/t8-,10+/m1/s1 |
| InChIKey | NZHQTZAMFVOAOH-JNQSDMCQSA-N |
| XLogP | 2.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|