About 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate (PubChem CID 11513925) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate |
| PubChem CID | 11513925 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate |
| SMILES | CC(=O)OCCC1(O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C10H12O4/c1-8(11)14-7-6-10(13)4-2-9(12)3-5-10/h2-5,13H,6-7H2,1H3 |
| InChIKey | OLSBSHYYMNUCIK-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate?
The IUPAC name of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate (CID 11513925) is 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate.
What is the SMILES notation for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate?
The canonical SMILES for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate is CC(=O)OCCC1(O)C=CC(=O)C=C1.
What is the InChIKey of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate?
The InChIKey is OLSBSHYYMNUCIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-8(11)14-7-6-10(13)4-2-9(12)3-5-10/h2-5,13H,6-7H2,1H3.
What are the key properties of 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate?
2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate has a molecular weight of 196.20 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)ethyl acetate is sourced from PubChem (CID 11513925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).