C13H16O2 — CID 11513968
7a-(prop-2-ynoxymethyl)-2,3,6,7-tetrahydro-1H-inden-5-one (PubChem CID 11513968) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 7a-(prop-2-ynoxymethyl)-2,3,6,7-tetrahydro-1H-inden-5-one.
| Compound Name | 7a-(prop-2-ynoxymethyl)-2,3,6,7-tetrahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 11513968 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 7a-(prop-2-ynoxymethyl)-2,3,6,7-tetrahydro-1H-inden-5-one |
| SMILES | C#CCOCC12CCCC1=CC(=O)CC2 |
| InChI | InChI=1S/C13H16O2/c1-2-8-15-10-13-6-3-4-11(13)9-12(14)5-7-13/h1,9H,3-8,10H2 |
| InChIKey | DPUGFMYEAZWIEK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|