C9H12BrNO2S — CID 115140158
N-[2-(5-bromothiophen-2-yl)ethyl]-2-hydroxy-N-methylacetamide (PubChem CID 115140158) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)ethyl]-2-hydroxy-N-methylacetamide.
| Compound Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-hydroxy-N-methylacetamide |
|---|---|
| PubChem CID | 115140158 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)ethyl]-2-hydroxy-N-methylacetamide |
| SMILES | CN(CCc1ccc(Br)s1)C(=O)CO |
| InChI | InChI=1S/C9H12BrNO2S/c1-11(9(13)6-12)5-4-7-2-3-8(10)14-7/h2-3,12H,4-6H2,1H3 |
| InChIKey | PBZWRHGVALEHLB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |