C8H10ClNO2S — CID 115140641
N-[(5-chlorothiophen-2-yl)methyl]-2-hydroxypropanamide (PubChem CID 115140641) has the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-hydroxypropanamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 115140641 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClNO2S/c1-5(11)8(12)10-4-6-2-3-7(9)13-6/h2-3,5,11H,4H2,1H3,(H,10,12) |
| InChIKey | XWWXYQYKRWWCHP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |