About 1-(5-methoxy-3-pyridinyl)-1,5-diazocane
1-(5-methoxy-3-pyridinyl)-1,5-diazocane (PubChem CID 11514075) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(5-methoxy-3-pyridinyl)-1,5-diazocane.
Molecular Properties
| Compound Name | 1-(5-methoxy-3-pyridinyl)-1,5-diazocane |
| PubChem CID | 11514075 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-(5-methoxy-3-pyridinyl)-1,5-diazocane |
| SMILES | COc1cncc(N2CCCNCCC2)c1 |
| InChI | InChI=1S/C12H19N3O/c1-16-12-8-11(9-14-10-12)15-6-2-4-13-5-3-7-15/h8-10,13H,2-7H2,1H3 |
| InChIKey | SHALYUZFJLUFSL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-methoxy-3-pyridinyl)-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methoxy-3-pyridinyl)-1,5-diazocane?
The IUPAC name of 1-(5-methoxy-3-pyridinyl)-1,5-diazocane (CID 11514075) is 1-(5-methoxy-3-pyridinyl)-1,5-diazocane.
What is the SMILES notation for 1-(5-methoxy-3-pyridinyl)-1,5-diazocane?
The canonical SMILES for 1-(5-methoxy-3-pyridinyl)-1,5-diazocane is COc1cncc(N2CCCNCCC2)c1.
What is the InChIKey of 1-(5-methoxy-3-pyridinyl)-1,5-diazocane?
The InChIKey is SHALYUZFJLUFSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-16-12-8-11(9-14-10-12)15-6-2-4-13-5-3-7-15/h8-10,13H,2-7H2,1H3.
What are the key properties of 1-(5-methoxy-3-pyridinyl)-1,5-diazocane?
1-(5-methoxy-3-pyridinyl)-1,5-diazocane has a molecular weight of 221.30 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methoxy-3-pyridinyl)-1,5-diazocane is sourced from PubChem (CID 11514075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).