C14H16N2O — CID 11514130
(9-amino-5,6,7,8-tetrahydroacridin-4-yl)methanol (PubChem CID 11514130) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is (9-amino-5,6,7,8-tetrahydroacridin-4-yl)methanol.
| Compound Name | (9-amino-5,6,7,8-tetrahydroacridin-4-yl)methanol |
|---|---|
| PubChem CID | 11514130 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | (9-amino-5,6,7,8-tetrahydroacridin-4-yl)methanol |
| SMILES | Nc1c2c(nc3c(CO)cccc13)CCCC2 |
| InChI | InChI=1S/C14H16N2O/c15-13-10-5-1-2-7-12(10)16-14-9(8-17)4-3-6-11(13)14/h3-4,6,17H,1-2,5,7-8H2,(H2,15,16) |
| InChIKey | LUWHOGXZYIVPJP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |