C12H13NO5 — CID 115141329
2-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]-2-oxoacetic acid (PubChem CID 115141329) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]-2-oxoacetic acid.
| Compound Name | 2-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 115141329 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)methylamino]-2-oxoacetic acid |
| SMILES | Cc1cc2c(cc1CNC(=O)C(=O)O)OCCO2 |
| InChI | InChI=1S/C12H13NO5/c1-7-4-9-10(18-3-2-17-9)5-8(7)6-13-11(14)12(15)16/h4-5H,2-3,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | IKINYUVOQCYCHK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|