About 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile
4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile (PubChem CID 115143543) has the molecular formula C13H9N5O2
and a molecular weight of 267.25 g/mol. Its IUPAC name is 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile.
Molecular Properties
| Compound Name | 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile |
| PubChem CID | 115143543 |
| Molecular Formula | C13H9N5O2 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile |
| SMILES | CN(c1ccc2ncoc2c1)c1cc(C#N)[nH]c(=O)n1 |
| InChI | InChI=1S/C13H9N5O2/c1-18(12-4-8(6-14)16-13(19)17-12)9-2-3-10-11(5-9)20-7-15-10/h2-5,7H,1H3,(H,16,17,19) |
| InChIKey | XVJQFRORQZHBIK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile?
The IUPAC name of 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile (CID 115143543) is 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile.
What is the SMILES notation for 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile?
The canonical SMILES for 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile is CN(c1ccc2ncoc2c1)c1cc(C#N)[nH]c(=O)n1.
What is the InChIKey of 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile?
The InChIKey is XVJQFRORQZHBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5O2/c1-18(12-4-8(6-14)16-13(19)17-12)9-2-3-10-11(5-9)20-7-15-10/h2-5,7H,1H3,(H,16,17,19).
What are the key properties of 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile?
4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile has a molecular weight of 267.25 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-benzoxazol-6-yl(methyl)amino]-2-oxo-1H-pyrimidine-6-carbonitrile is sourced from PubChem (CID 115143543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).