C9H20NO5P — CID 11514357
(2S,3R,4R,5S)-2-diethoxyphosphoryl-5-methylpyrrolidine-3,4-diol (PubChem CID 11514357) has the molecular formula C9H20NO5P and a molecular weight of 253.23 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-diethoxyphosphoryl-5-methylpyrrolidine-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-2-diethoxyphosphoryl-5-methylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11514357 |
| Molecular Formula | C9H20NO5P |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2S,3R,4R,5S)-2-diethoxyphosphoryl-5-methylpyrrolidine-3,4-diol |
| SMILES | CCOP(=O)(OCC)[C@@H]1N[C@@H](C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H20NO5P/c1-4-14-16(13,15-5-2)9-8(12)7(11)6(3)10-9/h6-12H,4-5H2,1-3H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | RCSBDIHGEWFMNM-KDXUFGMBSA-N |
| XLogP | 0.29 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|