C13H17NO5 — CID 115144426
2-[(2-methoxyphenyl)methyl-methylamino]butanedioic acid (PubChem CID 115144426) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl-methylamino]butanedioic acid.
| Compound Name | 2-[(2-methoxyphenyl)methyl-methylamino]butanedioic acid |
|---|---|
| PubChem CID | 115144426 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl-methylamino]butanedioic acid |
| SMILES | COc1ccccc1CN(C)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-14(10(13(17)18)7-12(15)16)8-9-5-3-4-6-11(9)19-2/h3-6,10H,7-8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | GVLVAERUCIGVTG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |