C12H15N5 — CID 115144787
N-methyl-N-(1H-pyrrol-2-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine (PubChem CID 115144787) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N-methyl-N-(1H-pyrrol-2-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-methyl-N-(1H-pyrrol-2-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 115144787 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-methyl-N-(1H-pyrrol-2-yl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CN(c1ccc[nH]1)c1ncnc2c1CNCC2 |
| InChI | InChI=1S/C12H15N5/c1-17(11-3-2-5-14-11)12-9-7-13-6-4-10(9)15-8-16-12/h2-3,5,8,13-14H,4,6-7H2,1H3 |
| InChIKey | DXAYBIUXGCTXDM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|