C14H15BrN4O — CID 115144905
4-(4-bromo-N-methylanilino)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 115144905) has the molecular formula C14H15BrN4O and a molecular weight of 335.21 g/mol. Its IUPAC name is 4-(4-bromo-N-methylanilino)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 4-(4-bromo-N-methylanilino)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 115144905 |
| Molecular Formula | C14H15BrN4O |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-(4-bromo-N-methylanilino)-5,6,7,8-tetrahydro-1H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | CN(c1ccc(Br)cc1)c1nc(=O)[nH]c2c1CNCC2 |
| InChI | InChI=1S/C14H15BrN4O/c1-19(10-4-2-9(15)3-5-10)13-11-8-16-7-6-12(11)17-14(20)18-13/h2-5,16H,6-8H2,1H3,(H,17,18,20) |
| InChIKey | ZFAUYNDQALMQHE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|