C18H24N2 — CID 115145390
2,2-dimethyl-N-(6-methylnaphthalen-2-yl)piperidin-4-amine (PubChem CID 115145390) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2,2-dimethyl-N-(6-methylnaphthalen-2-yl)piperidin-4-amine.
| Compound Name | 2,2-dimethyl-N-(6-methylnaphthalen-2-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 115145390 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2,2-dimethyl-N-(6-methylnaphthalen-2-yl)piperidin-4-amine |
| SMILES | Cc1ccc2cc(NC3CCNC(C)(C)C3)ccc2c1 |
| InChI | InChI=1S/C18H24N2/c1-13-4-5-15-11-16(7-6-14(15)10-13)20-17-8-9-19-18(2,3)12-17/h4-7,10-11,17,19-20H,8-9,12H2,1-3H3 |
| InChIKey | RFTKGJMHULRFRE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |