About (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole
(2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole (PubChem CID 11514543) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole.
Molecular Properties
| Compound Name | (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole |
| PubChem CID | 11514543 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole |
| SMILES | COC1=CC(c2ccco2)=N/C1=C\c1[nH]c(C)cc1C |
| InChI | InChI=1S/C16H16N2O2/c1-10-7-11(2)17-12(10)8-13-16(19-3)9-14(18-13)15-5-4-6-20-15/h4-9,17H,1-3H3/b13-8- |
| InChIKey | CUENRYSCWFNZMF-JYRVWZFOSA-N |
| XLogP | 3.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole?
The IUPAC name of (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole (CID 11514543) is (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole.
What is the SMILES notation for (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole?
The canonical SMILES for (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole is COC1=CC(c2ccco2)=N/C1=C\c1[nH]c(C)cc1C.
What is the InChIKey of (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole?
The InChIKey is CUENRYSCWFNZMF-JYRVWZFOSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-10-7-11(2)17-12(10)8-13-16(19-3)9-14(18-13)15-5-4-6-20-15/h4-9,17H,1-3H3/b13-8-.
What are the key properties of (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole?
(2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole has a molecular weight of 268.32 g/mol, XLogP of 3.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-5-(furan-2-yl)-3-methoxypyrrole is sourced from PubChem (CID 11514543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).