C16H21N3 — CID 115146441
2-(2,2-dimethylpentylamino)-1H-indole-3-carbonitrile (PubChem CID 115146441) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-(2,2-dimethylpentylamino)-1H-indole-3-carbonitrile.
| Compound Name | 2-(2,2-dimethylpentylamino)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 115146441 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-(2,2-dimethylpentylamino)-1H-indole-3-carbonitrile |
| SMILES | CCCC(C)(C)CNc1[nH]c2ccccc2c1C#N |
| InChI | InChI=1S/C16H21N3/c1-4-9-16(2,3)11-18-15-13(10-17)12-7-5-6-8-14(12)19-15/h5-8,18-19H,4,9,11H2,1-3H3 |
| InChIKey | LWIFGTPTKIIGNZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |