C13H13F3N4 — CID 11514685
5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 11514685) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 11514685 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 5-piperazin-1-yl-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | FC(F)(F)c1ccc2c(N3CCNCC3)nccc2n1 |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)11-2-1-9-10(19-11)3-4-18-12(9)20-7-5-17-6-8-20/h1-4,17H,5-8H2 |
| InChIKey | MIBMFJKAPFQBRL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |