About 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid
5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid (PubChem CID 11514746) has the molecular formula C14H11FN4O2
and a molecular weight of 286.27 g/mol. Its IUPAC name is 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid |
| PubChem CID | 11514746 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1NCc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C14H11FN4O2/c15-9-5-11(14(20)21)13(19-7-9)18-6-8-1-3-16-12-10(8)2-4-17-12/h1-5,7H,6H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | QSIFNOZETGFGEI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid?
The IUPAC name of 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid (CID 11514746) is 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid?
The canonical SMILES for 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid is O=C(O)c1cc(F)cnc1NCc1ccnc2[nH]ccc12.
What is the InChIKey of 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid?
The InChIKey is QSIFNOZETGFGEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4O2/c15-9-5-11(14(20)21)13(19-7-9)18-6-8-1-3-16-12-10(8)2-4-17-12/h1-5,7H,6H2,(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid?
5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid has a molecular weight of 286.27 g/mol, XLogP of 2.41, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)pyridine-3-carboxylic acid is sourced from PubChem (CID 11514746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).