C10H11Cl2F3Si — CID 11514753
[2,6-dichloro-4-(trifluoromethyl)phenyl]-trimethylsilane (PubChem CID 11514753) has the molecular formula C10H11Cl2F3Si and a molecular weight of 287.18 g/mol. Its IUPAC name is [2,6-dichloro-4-(trifluoromethyl)phenyl]-trimethylsilane.
| Compound Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11514753 |
| Molecular Formula | C10H11Cl2F3Si |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2,6-dichloro-4-(trifluoromethyl)phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11Cl2F3Si/c1-16(2,3)9-7(11)4-6(5-8(9)12)10(13,14)15/h4-5H,1-3H3 |
| InChIKey | PQWSZUVYYPSBBS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|