About 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine
2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine (PubChem CID 115148047) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine |
| PubChem CID | 115148047 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine |
| SMILES | Cc1cc(N)cnc1N(C)CCc1ccc[nH]1 |
| InChI | InChI=1S/C13H18N4/c1-10-8-11(14)9-16-13(10)17(2)7-5-12-4-3-6-15-12/h3-4,6,8-9,15H,5,7,14H2,1-2H3 |
| InChIKey | BFBVJRZTHNGINI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine?
The IUPAC name of 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine (CID 115148047) is 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine.
What is the SMILES notation for 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine?
The canonical SMILES for 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine is Cc1cc(N)cnc1N(C)CCc1ccc[nH]1.
What is the InChIKey of 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine?
The InChIKey is BFBVJRZTHNGINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c1-10-8-11(14)9-16-13(10)17(2)7-5-12-4-3-6-15-12/h3-4,6,8-9,15H,5,7,14H2,1-2H3.
What are the key properties of 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine?
2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine has a molecular weight of 230.31 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-dimethyl-2-N-[2-(1H-pyrrol-2-yl)ethyl]pyridine-2,5-diamine is sourced from PubChem (CID 115148047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).