C15H21F2NO — CID 115149605
4-[2-(2,5-difluorophenyl)ethyl-methylamino]cyclohexan-1-ol (PubChem CID 115149605) has the molecular formula C15H21F2NO and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-[2-(2,5-difluorophenyl)ethyl-methylamino]cyclohexan-1-ol.
| Compound Name | 4-[2-(2,5-difluorophenyl)ethyl-methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 115149605 |
| Molecular Formula | C15H21F2NO |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-[2-(2,5-difluorophenyl)ethyl-methylamino]cyclohexan-1-ol |
| SMILES | CN(CCc1cc(F)ccc1F)C1CCC(O)CC1 |
| InChI | InChI=1S/C15H21F2NO/c1-18(13-3-5-14(19)6-4-13)9-8-11-10-12(16)2-7-15(11)17/h2,7,10,13-14,19H,3-6,8-9H2,1H3 |
| InChIKey | DMXFNGVVBXSWTA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |