C18H22O4 — CID 11514975
[(3S,4S)-4-(4-methoxy-2,3-dimethylphenoxy)hexa-1,5-dien-3-yl] prop-2-enoate (PubChem CID 11514975) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(3S,4S)-4-(4-methoxy-2,3-dimethylphenoxy)hexa-1,5-dien-3-yl] prop-2-enoate.
| Compound Name | [(3S,4S)-4-(4-methoxy-2,3-dimethylphenoxy)hexa-1,5-dien-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11514975 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(3S,4S)-4-(4-methoxy-2,3-dimethylphenoxy)hexa-1,5-dien-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](C=C)[C@H](C=C)Oc1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C18H22O4/c1-7-14(15(8-2)22-18(19)9-3)21-17-11-10-16(20-6)12(4)13(17)5/h7-11,14-15H,1-3H2,4-6H3/t14-,15-/m0/s1 |
| InChIKey | SKRFOLZGEGZPKG-GJZGRUSLSA-N |
| XLogP | 3.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|