C16H21BrN2 — CID 115150304
4-[2-(3-bromophenyl)ethyl-methylamino]cyclohexane-1-carbonitrile (PubChem CID 115150304) has the molecular formula C16H21BrN2 and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-[2-(3-bromophenyl)ethyl-methylamino]cyclohexane-1-carbonitrile.
| Compound Name | 4-[2-(3-bromophenyl)ethyl-methylamino]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 115150304 |
| Molecular Formula | C16H21BrN2 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[2-(3-bromophenyl)ethyl-methylamino]cyclohexane-1-carbonitrile |
| SMILES | CN(CCc1cccc(Br)c1)C1CCC(C#N)CC1 |
| InChI | InChI=1S/C16H21BrN2/c1-19(16-7-5-14(12-18)6-8-16)10-9-13-3-2-4-15(17)11-13/h2-4,11,14,16H,5-10H2,1H3 |
| InChIKey | CVRQZFDVMWRFRL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |