C14H26N2 — CID 115150321
4-(2,2,3-trimethylbutylamino)cyclohexane-1-carbonitrile (PubChem CID 115150321) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 4-(2,2,3-trimethylbutylamino)cyclohexane-1-carbonitrile.
| Compound Name | 4-(2,2,3-trimethylbutylamino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 115150321 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 4-(2,2,3-trimethylbutylamino)cyclohexane-1-carbonitrile |
| SMILES | CC(C)C(C)(C)CNC1CCC(C#N)CC1 |
| InChI | InChI=1S/C14H26N2/c1-11(2)14(3,4)10-16-13-7-5-12(9-15)6-8-13/h11-13,16H,5-8,10H2,1-4H3 |
| InChIKey | WBIUJSISHDBVNR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |