C13H24N2O3 — CID 115151399
1-(methylamino)-4-[methyl(propan-2-yl)carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 115151399) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 1-(methylamino)-4-[methyl(propan-2-yl)carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-(methylamino)-4-[methyl(propan-2-yl)carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115151399 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 1-(methylamino)-4-[methyl(propan-2-yl)carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CNC1(C(=O)O)CCC(C(=O)N(C)C(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O3/c1-9(2)15(4)11(16)10-5-7-13(14-3,8-6-10)12(17)18/h9-10,14H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | XQXHJYYKJMDNDI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |