C21H25N3 — CID 11515256
7-(4-benzylpiperidin-1-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 11515256) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 7-(4-benzylpiperidin-1-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 7-(4-benzylpiperidin-1-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 11515256 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 7-(4-benzylpiperidin-1-yl)-2,3-dimethyl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | Cc1[nH]c2c(N3CCC(Cc4ccccc4)CC3)nccc2c1C |
| InChI | InChI=1S/C21H25N3/c1-15-16(2)23-20-19(15)8-11-22-21(20)24-12-9-18(10-13-24)14-17-6-4-3-5-7-17/h3-8,11,18,23H,9-10,12-14H2,1-2H3 |
| InChIKey | NWYFRIQJZBDYIT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |