C16H18ClN3O2 — CID 11515258
[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate (PubChem CID 11515258) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate.
| Compound Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 11515258 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl 6-chloroimidazo[1,2-a]pyridine-8-carboxylate |
| SMILES | O=C(OC[C@@H]1CCN2CCC[C@@H]12)c1cc(Cl)cn2ccnc12 |
| InChI | InChI=1S/C16H18ClN3O2/c17-12-8-13(15-18-4-7-20(15)9-12)16(21)22-10-11-3-6-19-5-1-2-14(11)19/h4,7-9,11,14H,1-3,5-6,10H2/t11-,14-/m0/s1 |
| InChIKey | JVMOCSXJYUVGSO-FZMZJTMJSA-N |
| XLogP | 2.63 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |