C14H19N3O2 — CID 115154334
1-(3-aminobutanoyl)-5-(2-aminoethyl)-3H-indol-2-one (PubChem CID 115154334) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(3-aminobutanoyl)-5-(2-aminoethyl)-3H-indol-2-one.
| Compound Name | 1-(3-aminobutanoyl)-5-(2-aminoethyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 115154334 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-(3-aminobutanoyl)-5-(2-aminoethyl)-3H-indol-2-one |
| SMILES | CC(N)CC(=O)N1C(=O)Cc2cc(CCN)ccc21 |
| InChI | InChI=1S/C14H19N3O2/c1-9(16)6-13(18)17-12-3-2-10(4-5-15)7-11(12)8-14(17)19/h2-3,7,9H,4-6,8,15-16H2,1H3 |
| InChIKey | BLTPZGFYISCNKS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |