C10H15BrN2OS — CID 115154895
3-amino-N-(5-bromothiophen-2-yl)-N,3-dimethylbutanamide (PubChem CID 115154895) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 3-amino-N-(5-bromothiophen-2-yl)-N,3-dimethylbutanamide.
| Compound Name | 3-amino-N-(5-bromothiophen-2-yl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 115154895 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-amino-N-(5-bromothiophen-2-yl)-N,3-dimethylbutanamide |
| SMILES | CN(C(=O)CC(C)(C)N)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H15BrN2OS/c1-10(2,12)6-8(14)13(3)9-5-4-7(11)15-9/h4-5H,6,12H2,1-3H3 |
| InChIKey | SRJRKNZMFMUNEH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |