C20H33NO3 — CID 11515538
2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]acetic acid (PubChem CID 11515538) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]acetic acid.
| Compound Name | 2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11515538 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]acetic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C20H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)21-18-20(23)24/h3-4,6-7,9-10H,2,5,8,11-18H2,1H3,(H,21,22)(H,23,24)/b4-3-,7-6-,10-9- |
| InChIKey | QYPLHBZIMGVCOV-PDBXOOCHSA-N |
| XLogP | 4.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|