C13H13F3O5S — CID 11515583
spiro[1,3-dioxolane-2,7'-6,8-dihydro-5H-naphthalene]-1'-yl trifluoromethanesulfonate (PubChem CID 11515583) has the molecular formula C13H13F3O5S and a molecular weight of 338.30 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,7'-6,8-dihydro-5H-naphthalene]-1'-yl trifluoromethanesulfonate.
| Compound Name | spiro[1,3-dioxolane-2,7'-6,8-dihydro-5H-naphthalene]-1'-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11515583 |
| Molecular Formula | C13H13F3O5S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | spiro[1,3-dioxolane-2,7'-6,8-dihydro-5H-naphthalene]-1'-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc2c1CC1(CC2)OCCO1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O5S/c14-13(15,16)22(17,18)21-11-3-1-2-9-4-5-12(8-10(9)11)19-6-7-20-12/h1-3H,4-8H2 |
| InChIKey | DWIOJAJUFUFPNE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|