C15H18N2O5S — CID 11515586
5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1-methylindole-2,3-dione (PubChem CID 11515586) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1-methylindole-2,3-dione.
| Compound Name | 5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1-methylindole-2,3-dione |
|---|---|
| PubChem CID | 11515586 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]sulfonyl-1-methylindole-2,3-dione |
| SMILES | COC[C@@H]1CCCN1S(=O)(=O)c1ccc2c(c1)C(=O)C(=O)N2C |
| InChI | InChI=1S/C15H18N2O5S/c1-16-13-6-5-11(8-12(13)14(18)15(16)19)23(20,21)17-7-3-4-10(17)9-22-2/h5-6,8,10H,3-4,7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | SMINLRKVPPXJGK-JTQLQIEISA-N |
| XLogP | 0.65 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|