C13H23N3O — CID 115156513
4-amino-3-methyl-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]butanamide (PubChem CID 115156513) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 4-amino-3-methyl-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]butanamide.
| Compound Name | 4-amino-3-methyl-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 115156513 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 4-amino-3-methyl-N-[2-methyl-2-(1H-pyrrol-2-yl)propyl]butanamide |
| SMILES | CC(CN)CC(=O)NCC(C)(C)c1ccc[nH]1 |
| InChI | InChI=1S/C13H23N3O/c1-10(8-14)7-12(17)16-9-13(2,3)11-5-4-6-15-11/h4-6,10,15H,7-9,14H2,1-3H3,(H,16,17) |
| InChIKey | BXQBRPQZSREXTK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |