About 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide
4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide (PubChem CID 115156893) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide.
Molecular Properties
| Compound Name | 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide |
| PubChem CID | 115156893 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide |
| SMILES | CC(C)(CCN)C(=O)Nc1cc[nH]c1 |
| InChI | InChI=1S/C10H17N3O/c1-10(2,4-5-11)9(14)13-8-3-6-12-7-8/h3,6-7,12H,4-5,11H2,1-2H3,(H,13,14) |
| InChIKey | IDYRIFGARBDHRA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide?
The IUPAC name of 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide (CID 115156893) is 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide.
What is the SMILES notation for 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide?
The canonical SMILES for 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide is CC(C)(CCN)C(=O)Nc1cc[nH]c1.
What is the InChIKey of 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide?
The InChIKey is IDYRIFGARBDHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-10(2,4-5-11)9(14)13-8-3-6-12-7-8/h3,6-7,12H,4-5,11H2,1-2H3,(H,13,14).
What are the key properties of 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide?
4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide has a molecular weight of 195.27 g/mol, XLogP of 1.33, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-dimethyl-N-(1H-pyrrol-3-yl)butanamide is sourced from PubChem (CID 115156893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).