C20H20O4S — CID 11515952
(1S,2S,7R,8R)-4-methoxy-7-methyl-2-[(S)-(4-methylphenyl)sulfinyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 11515952) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is (1S,2S,7R,8R)-4-methoxy-7-methyl-2-[(S)-(4-methylphenyl)sulfinyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | (1S,2S,7R,8R)-4-methoxy-7-methyl-2-[(S)-(4-methylphenyl)sulfinyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 11515952 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (1S,2S,7R,8R)-4-methoxy-7-methyl-2-[(S)-(4-methylphenyl)sulfinyl]tricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | COC1=CC(=O)[C@@]2(C)[C@H]3C=C[C@H](C3)[C@@]2([S@@](=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C20H20O4S/c1-12-4-8-15(9-5-12)25(23)20-14-7-6-13(10-14)19(20,2)17(21)11-16(24-3)18(20)22/h4-9,11,13-14H,10H2,1-3H3/t13-,14+,19+,20+,25-/m0/s1 |
| InChIKey | NVUHKPYRMMKXGZ-OOHYCTPRSA-N |
| XLogP | 2.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|