C14H19BrN2O — CID 115160586
N-(3-bromophenyl)-N-methyl-2-piperidin-3-ylacetamide (PubChem CID 115160586) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-methyl-2-piperidin-3-ylacetamide.
| Compound Name | N-(3-bromophenyl)-N-methyl-2-piperidin-3-ylacetamide |
|---|---|
| PubChem CID | 115160586 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(3-bromophenyl)-N-methyl-2-piperidin-3-ylacetamide |
| SMILES | CN(C(=O)CC1CCCNC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O/c1-17(13-6-2-5-12(15)9-13)14(18)8-11-4-3-7-16-10-11/h2,5-6,9,11,16H,3-4,7-8,10H2,1H3 |
| InChIKey | SWMYRIUOIVUVPG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |