C14H20N2O — CID 115161310
3-amino-N-(2,4,5-trimethylphenyl)cyclobutane-1-carboxamide (PubChem CID 115161310) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-amino-N-(2,4,5-trimethylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 3-amino-N-(2,4,5-trimethylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 115161310 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-amino-N-(2,4,5-trimethylphenyl)cyclobutane-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)C2CC(N)C2)cc1C |
| InChI | InChI=1S/C14H20N2O/c1-8-4-10(3)13(5-9(8)2)16-14(17)11-6-12(15)7-11/h4-5,11-12H,6-7,15H2,1-3H3,(H,16,17) |
| InChIKey | UJFFVSUWZUTBCY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |