About 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol
4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol (PubChem CID 11516181) has the molecular formula C20H20N2O3S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol.
Molecular Properties
| Compound Name | 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol |
| PubChem CID | 11516181 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol |
| SMILES | CCC1c2cccn2-c2ccccc2N1S(=O)(=O)c1ccc(O)c(C)c1 |
| InChI | InChI=1S/C20H20N2O3S/c1-3-16-17-9-6-12-21(17)18-7-4-5-8-19(18)22(16)26(24,25)15-10-11-20(23)14(2)13-15/h4-13,16,23H,3H2,1-2H3 |
| InChIKey | SEOWXHWPXUCTRW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol?
The IUPAC name of 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol (CID 11516181) is 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol.
What is the SMILES notation for 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol?
The canonical SMILES for 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol is CCC1c2cccn2-c2ccccc2N1S(=O)(=O)c1ccc(O)c(C)c1.
What is the InChIKey of 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol?
The InChIKey is SEOWXHWPXUCTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O3S/c1-3-16-17-9-6-12-21(17)18-7-4-5-8-19(18)22(16)26(24,25)15-10-11-20(23)14(2)13-15/h4-13,16,23H,3H2,1-2H3.
What are the key properties of 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol?
4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol has a molecular weight of 368.46 g/mol, XLogP of 4.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethyl-4H-pyrrolo[1,2-a]quinoxalin-5-yl)sulfonyl]-2-methylphenol is sourced from PubChem (CID 11516181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).