C11H15ClN2O — CID 115162284
2-chloro-N-(2-methyl-2-pyridin-4-ylpropyl)acetamide (PubChem CID 115162284) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-chloro-N-(2-methyl-2-pyridin-4-ylpropyl)acetamide.
| Compound Name | 2-chloro-N-(2-methyl-2-pyridin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 115162284 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-chloro-N-(2-methyl-2-pyridin-4-ylpropyl)acetamide |
| SMILES | CC(C)(CNC(=O)CCl)c1ccncc1 |
| InChI | InChI=1S/C11H15ClN2O/c1-11(2,8-14-10(15)7-12)9-3-5-13-6-4-9/h3-6H,7-8H2,1-2H3,(H,14,15) |
| InChIKey | IPBUARBDPMNFOK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|