C20H22N3O2+ — CID 11516255
17-ethyl-9-methyl-6,13-dioxa-2,17-diaza-9-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,9,11,15,21-heptaene (PubChem CID 11516255) has the molecular formula C20H22N3O2+ and a molecular weight of 336.42 g/mol. Its IUPAC name is 17-ethyl-9-methyl-6,13-dioxa-2,17-diaza-9-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,9,11,15,21-heptaene.
| Compound Name | 17-ethyl-9-methyl-6,13-dioxa-2,17-diaza-9-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,9,11,15,21-heptaene |
|---|---|
| PubChem CID | 11516255 |
| Molecular Formula | C20H22N3O2+ |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 17-ethyl-9-methyl-6,13-dioxa-2,17-diaza-9-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),2,4,9,11,15,21-heptaene |
| SMILES | CCN1CCCc2cc3c(cc21)Oc1cc2c(cc1=N3)OCC[N+]=2C |
| InChI | InChI=1S/C20H22N3O2/c1-3-23-6-4-5-13-9-14-18(11-16(13)23)25-19-12-17-20(10-15(19)21-14)24-8-7-22(17)2/h9-12H,3-8H2,1-2H3/q+1 |
| InChIKey | MUSLDYGBSCXODO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|