C15H23NO2 — CID 115163128
4-hydroxy-N-[2-(2,3,4-trimethylphenyl)ethyl]butanamide (PubChem CID 115163128) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-hydroxy-N-[2-(2,3,4-trimethylphenyl)ethyl]butanamide.
| Compound Name | 4-hydroxy-N-[2-(2,3,4-trimethylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 115163128 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-hydroxy-N-[2-(2,3,4-trimethylphenyl)ethyl]butanamide |
| SMILES | Cc1ccc(CCNC(=O)CCCO)c(C)c1C |
| InChI | InChI=1S/C15H23NO2/c1-11-6-7-14(13(3)12(11)2)8-9-16-15(18)5-4-10-17/h6-7,17H,4-5,8-10H2,1-3H3,(H,16,18) |
| InChIKey | GVTGIEGNNHABKT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |